C12H13F2NO — CID 105404516
3-[(3,5-difluorophenyl)methyl]piperidin-4-one (PubChem CID 105404516) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)methyl]piperidin-4-one.
| Compound Name | 3-[(3,5-difluorophenyl)methyl]piperidin-4-one |
|---|---|
| PubChem CID | 105404516 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-[(3,5-difluorophenyl)methyl]piperidin-4-one |
| SMILES | O=C1CCNCC1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H13F2NO/c13-10-4-8(5-11(14)6-10)3-9-7-15-2-1-12(9)16/h4-6,9,15H,1-3,7H2 |
| InChIKey | NRTAEDMJPKHBGQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |