C16H15ClO3 — CID 105405731
3-(4-chloro-2,6-dimethylphenoxy)-4-methylbenzoic acid (PubChem CID 105405731) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 3-(4-chloro-2,6-dimethylphenoxy)-4-methylbenzoic acid.
| Compound Name | 3-(4-chloro-2,6-dimethylphenoxy)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 105405731 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-(4-chloro-2,6-dimethylphenoxy)-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1Oc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C16H15ClO3/c1-9-4-5-12(16(18)19)8-14(9)20-15-10(2)6-13(17)7-11(15)3/h4-8H,1-3H3,(H,18,19) |
| InChIKey | ULFWHSAYKMJWAV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |