C15H17ClN2 — CID 105405946
1-[5-(chloromethyl)-2-methylphenyl]-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 105405946) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-2-methylphenyl]-4,5,6,7-tetrahydrobenzimidazole.
| Compound Name | 1-[5-(chloromethyl)-2-methylphenyl]-4,5,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 105405946 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-[5-(chloromethyl)-2-methylphenyl]-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | Cc1ccc(CCl)cc1-n1cnc2c1CCCC2 |
| InChI | InChI=1S/C15H17ClN2/c1-11-6-7-12(9-16)8-15(11)18-10-17-13-4-2-3-5-14(13)18/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | KOLFZRQWWGJTBR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|