C11H6BrCl2IN2 — CID 105408003
2-(3-bromo-4-methylphenyl)-4,6-dichloro-5-iodopyrimidine (PubChem CID 105408003) has the molecular formula C11H6BrCl2IN2 and a molecular weight of 443.90 g/mol. Its IUPAC name is 2-(3-bromo-4-methylphenyl)-4,6-dichloro-5-iodopyrimidine.
| Compound Name | 2-(3-bromo-4-methylphenyl)-4,6-dichloro-5-iodopyrimidine |
|---|---|
| PubChem CID | 105408003 |
| Molecular Formula | C11H6BrCl2IN2 |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 441.81 |
| IUPAC Name | 2-(3-bromo-4-methylphenyl)-4,6-dichloro-5-iodopyrimidine |
| SMILES | Cc1ccc(-c2nc(Cl)c(I)c(Cl)n2)cc1Br |
| InChI | InChI=1S/C11H6BrCl2IN2/c1-5-2-3-6(4-7(5)12)11-16-9(13)8(15)10(14)17-11/h2-4H,1H3 |
| InChIKey | CZXXUWVTWXCFIL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|