C18H27F2N — CID 105408236
N-[2-[(3,5-difluorophenyl)methyl]-2-ethylhexyl]cyclopropanamine (PubChem CID 105408236) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is N-[2-[(3,5-difluorophenyl)methyl]-2-ethylhexyl]cyclopropanamine.
| Compound Name | N-[2-[(3,5-difluorophenyl)methyl]-2-ethylhexyl]cyclopropanamine |
|---|---|
| PubChem CID | 105408236 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-[2-[(3,5-difluorophenyl)methyl]-2-ethylhexyl]cyclopropanamine |
| SMILES | CCCCC(CC)(CNC1CC1)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H27F2N/c1-3-5-8-18(4-2,13-21-17-6-7-17)12-14-9-15(19)11-16(20)10-14/h9-11,17,21H,3-8,12-13H2,1-2H3 |
| InChIKey | QAPHHQAVNYZBBE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |