C18H17FN2 — CID 105409033
3-[5-[(cyclopropylamino)methyl]-2-methylphenyl]-5-fluorobenzonitrile (PubChem CID 105409033) has the molecular formula C18H17FN2 and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-[5-[(cyclopropylamino)methyl]-2-methylphenyl]-5-fluorobenzonitrile.
| Compound Name | 3-[5-[(cyclopropylamino)methyl]-2-methylphenyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 105409033 |
| Molecular Formula | C18H17FN2 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-[5-[(cyclopropylamino)methyl]-2-methylphenyl]-5-fluorobenzonitrile |
| SMILES | Cc1ccc(CNC2CC2)cc1-c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C18H17FN2/c1-12-2-3-13(11-21-17-4-5-17)8-18(12)15-6-14(10-20)7-16(19)9-15/h2-3,6-9,17,21H,4-5,11H2,1H3 |
| InChIKey | CYLDANNUYAKXGL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |