C16H16BrF2N — CID 105409034
N-benzyl-2-bromo-N-[(3,5-difluorophenyl)methyl]ethanamine (PubChem CID 105409034) has the molecular formula C16H16BrF2N and a molecular weight of 340.21 g/mol. Its IUPAC name is N-benzyl-2-bromo-N-[(3,5-difluorophenyl)methyl]ethanamine.
| Compound Name | N-benzyl-2-bromo-N-[(3,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105409034 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-benzyl-2-bromo-N-[(3,5-difluorophenyl)methyl]ethanamine |
| SMILES | Fc1cc(F)cc(CN(CCBr)Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H16BrF2N/c17-6-7-20(11-13-4-2-1-3-5-13)12-14-8-15(18)10-16(19)9-14/h1-5,8-10H,6-7,11-12H2 |
| InChIKey | CZMKUOTVBNFTRH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|