C18H23N — CID 105409508
N-methyl-1-[4-methyl-3-(3-propylphenyl)phenyl]methanamine (PubChem CID 105409508) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-methyl-1-[4-methyl-3-(3-propylphenyl)phenyl]methanamine.
| Compound Name | N-methyl-1-[4-methyl-3-(3-propylphenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 105409508 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-methyl-1-[4-methyl-3-(3-propylphenyl)phenyl]methanamine |
| SMILES | CCCc1cccc(-c2cc(CNC)ccc2C)c1 |
| InChI | InChI=1S/C18H23N/c1-4-6-15-7-5-8-17(11-15)18-12-16(13-19-3)10-9-14(18)2/h5,7-12,19H,4,6,13H2,1-3H3 |
| InChIKey | JSXXEJUIHCNWRR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |