C16H26O2S — CID 10540986
(1R,4S)-3-butyl-2-tert-butylsulfonyl-5-deuteriobicyclo[2.2.2]octa-2,5-diene (PubChem CID 10540986) has the molecular formula C16H26O2S and a molecular weight of 283.46 g/mol. Its IUPAC name is (1R,4S)-3-butyl-2-tert-butylsulfonyl-5-deuteriobicyclo[2.2.2]octa-2,5-diene.
| Compound Name | (1R,4S)-3-butyl-2-tert-butylsulfonyl-5-deuteriobicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 10540986 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (1R,4S)-3-butyl-2-tert-butylsulfonyl-5-deuteriobicyclo[2.2.2]octa-2,5-diene |
| SMILES | [2H]C1=C[C@H]2CC[C@@H]1C(CCCC)=C2S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C16H26O2S/c1-5-6-7-14-12-8-10-13(11-9-12)15(14)19(17,18)16(2,3)4/h8,10,12-13H,5-7,9,11H2,1-4H3/t12-,13+/m1/s1/i8D |
| InChIKey | ZLQMZCNHOWGRDN-RWYOHBPWSA-N |
| XLogP | 4.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|