C16H24F2N2 — CID 105410061
5-butan-2-yl-1-[(3,5-difluorophenyl)methyl]-2-methylpiperazine (PubChem CID 105410061) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 5-butan-2-yl-1-[(3,5-difluorophenyl)methyl]-2-methylpiperazine.
| Compound Name | 5-butan-2-yl-1-[(3,5-difluorophenyl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 105410061 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 5-butan-2-yl-1-[(3,5-difluorophenyl)methyl]-2-methylpiperazine |
| SMILES | CCC(C)C1CN(Cc2cc(F)cc(F)c2)C(C)CN1 |
| InChI | InChI=1S/C16H24F2N2/c1-4-11(2)16-10-20(12(3)8-19-16)9-13-5-14(17)7-15(18)6-13/h5-7,11-12,16,19H,4,8-10H2,1-3H3 |
| InChIKey | IHQFUVXYZXIVAP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |