C10H9F2N — CID 105411336
3-[(3,5-difluorophenyl)methylidene]azetidine (PubChem CID 105411336) has the molecular formula C10H9F2N and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)methylidene]azetidine.
| Compound Name | 3-[(3,5-difluorophenyl)methylidene]azetidine |
|---|---|
| PubChem CID | 105411336 |
| Molecular Formula | C10H9F2N |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-[(3,5-difluorophenyl)methylidene]azetidine |
| SMILES | Fc1cc(F)cc(C=C2CNC2)c1 |
| InChI | InChI=1S/C10H9F2N/c11-9-2-7(3-10(12)4-9)1-8-5-13-6-8/h1-4,13H,5-6H2 |
| InChIKey | RHYQSZNRSLPXQD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |