C13H10F3NO2S — CID 105411581
2-[(3,5-difluorophenyl)methylsulfonyl]-5-fluoroaniline (PubChem CID 105411581) has the molecular formula C13H10F3NO2S and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methylsulfonyl]-5-fluoroaniline.
| Compound Name | 2-[(3,5-difluorophenyl)methylsulfonyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 105411581 |
| Molecular Formula | C13H10F3NO2S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methylsulfonyl]-5-fluoroaniline |
| SMILES | Nc1cc(F)ccc1S(=O)(=O)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H10F3NO2S/c14-9-1-2-13(12(17)6-9)20(18,19)7-8-3-10(15)5-11(16)4-8/h1-6H,7,17H2 |
| InChIKey | PBGYRXXRYIWDAR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|