About 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate
5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate (PubChem CID 10541178) has the molecular formula C14H16F2O4
and a molecular weight of 286.27 g/mol. Its IUPAC name is 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate.
Molecular Properties
| Compound Name | 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate |
| PubChem CID | 10541178 |
| Molecular Formula | C14H16F2O4 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate |
| SMILES | CCOC(=O)C(F)(F)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H16F2O4/c1-2-19-13(18)14(15,16)9-8-12(17)20-10-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | SACHMEPHNHFNGM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate?
The IUPAC name of 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate (CID 10541178) is 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate.
What is the SMILES notation for 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate?
The canonical SMILES for 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate is CCOC(=O)C(F)(F)CCC(=O)OCc1ccccc1.
What is the InChIKey of 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate?
The InChIKey is SACHMEPHNHFNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2O4/c1-2-19-13(18)14(15,16)9-8-12(17)20-10-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3.
What are the key properties of 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate?
5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate has a molecular weight of 286.27 g/mol, XLogP of 2.71, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-benzyl 1-O-ethyl 2,2-difluoropentanedioate is sourced from PubChem (CID 10541178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).