C17H26N2O — CID 105414481
N,N-dimethyl-1-[[(4-prop-2-enoxyphenyl)methylamino]methyl]cyclobutan-1-amine (PubChem CID 105414481) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is N,N-dimethyl-1-[[(4-prop-2-enoxyphenyl)methylamino]methyl]cyclobutan-1-amine.
| Compound Name | N,N-dimethyl-1-[[(4-prop-2-enoxyphenyl)methylamino]methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 105414481 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N,N-dimethyl-1-[[(4-prop-2-enoxyphenyl)methylamino]methyl]cyclobutan-1-amine |
| SMILES | C=CCOc1ccc(CNCC2(N(C)C)CCC2)cc1 |
| InChI | InChI=1S/C17H26N2O/c1-4-12-20-16-8-6-15(7-9-16)13-18-14-17(19(2)3)10-5-11-17/h4,6-9,18H,1,5,10-14H2,2-3H3 |
| InChIKey | XKMYJCUZHZWMSY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|