C16H25FN2O — CID 105415634
(1R)-1-[2-[[1-(dimethylamino)cyclobutyl]methyl-methylamino]-6-fluorophenyl]ethanol (PubChem CID 105415634) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is (1R)-1-[2-[[1-(dimethylamino)cyclobutyl]methyl-methylamino]-6-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[2-[[1-(dimethylamino)cyclobutyl]methyl-methylamino]-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 105415634 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (1R)-1-[2-[[1-(dimethylamino)cyclobutyl]methyl-methylamino]-6-fluorophenyl]ethanol |
| SMILES | C[C@@H](O)c1c(F)cccc1N(C)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C16H25FN2O/c1-12(20)15-13(17)7-5-8-14(15)19(4)11-16(18(2)3)9-6-10-16/h5,7-8,12,20H,6,9-11H2,1-4H3/t12-/m1/s1 |
| InChIKey | IDIJVYDGYIWCAB-GFCCVEGCSA-N |
| XLogP | 2.80 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |