About methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate
methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 10541570) has the molecular formula C12H12F3NO4
and a molecular weight of 291.23 g/mol. Its IUPAC name is methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate.
Molecular Properties
| Compound Name | methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate |
| PubChem CID | 10541570 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4/c1-19-10(17)9(12(13,14)15)16-11(18)20-7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | ULHMLACUUBNDDD-SECBINFHSA-N |
| XLogP | 2.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate?
The IUPAC name of methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate (CID 10541570) is methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate.
What is the SMILES notation for methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate?
The canonical SMILES for methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate is COC(=O)[C@@H](NC(=O)OCc1ccccc1)C(F)(F)F.
What is the InChIKey of methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate?
The InChIKey is ULHMLACUUBNDDD-SECBINFHSA-N. The full InChI is InChI=1S/C12H12F3NO4/c1-19-10(17)9(12(13,14)15)16-11(18)20-7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,16,18)/t9-/m1/s1.
What are the key properties of methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate?
methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate has a molecular weight of 291.23 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3,3,3-trifluoro-2-(phenylmethoxycarbonylamino)propanoate is sourced from PubChem (CID 10541570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).