C10H21FN2 — CID 105416506
1-[(3-fluoropropylamino)methyl]-N,N-dimethylcyclobutan-1-amine (PubChem CID 105416506) has the molecular formula C10H21FN2 and a molecular weight of 188.29 g/mol. Its IUPAC name is 1-[(3-fluoropropylamino)methyl]-N,N-dimethylcyclobutan-1-amine.
| Compound Name | 1-[(3-fluoropropylamino)methyl]-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 105416506 |
| Molecular Formula | C10H21FN2 |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | 1-[(3-fluoropropylamino)methyl]-N,N-dimethylcyclobutan-1-amine |
| SMILES | CN(C)C1(CNCCCF)CCC1 |
| InChI | InChI=1S/C10H21FN2/c1-13(2)10(5-3-6-10)9-12-8-4-7-11/h12H,3-9H2,1-2H3 |
| InChIKey | DAYITLYUSOJTMS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|