C17H24O4 — CID 10541675
[(4S,6E)-2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate (PubChem CID 10541675) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(4S,6E)-2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate.
| Compound Name | [(4S,6E)-2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate |
|---|---|
| PubChem CID | 10541675 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(4S,6E)-2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate |
| SMILES | CC(=O)O[C@H](C=C(C)C)C/C(C)=C/CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C17H24O4/c1-12(2)8-16(21-14(4)18)9-13(3)6-5-7-15-10-17(19)20-11-15/h6,8,10,16H,5,7,9,11H2,1-4H3/b13-6+/t16-/m1/s1 |
| InChIKey | XQRJJNVCCOFALB-MSXUNZPYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|