C9H19FN2 — CID 105417009
1-[(2-fluoroethylamino)methyl]-N,N-dimethylcyclobutan-1-amine (PubChem CID 105417009) has the molecular formula C9H19FN2 and a molecular weight of 174.26 g/mol. Its IUPAC name is 1-[(2-fluoroethylamino)methyl]-N,N-dimethylcyclobutan-1-amine.
| Compound Name | 1-[(2-fluoroethylamino)methyl]-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 105417009 |
| Molecular Formula | C9H19FN2 |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | 1-[(2-fluoroethylamino)methyl]-N,N-dimethylcyclobutan-1-amine |
| SMILES | CN(C)C1(CNCCF)CCC1 |
| InChI | InChI=1S/C9H19FN2/c1-12(2)9(4-3-5-9)8-11-7-6-10/h11H,3-8H2,1-2H3 |
| InChIKey | LNAMIHNMGAPRAH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|