C17H28O2Si — CID 10541710
(3aS,3bR,4R,6aS)-3a,5,5-trimethyl-4-trimethylsilyloxy-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one (PubChem CID 10541710) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is (3aS,3bR,4R,6aS)-3a,5,5-trimethyl-4-trimethylsilyloxy-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one.
| Compound Name | (3aS,3bR,4R,6aS)-3a,5,5-trimethyl-4-trimethylsilyloxy-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one |
|---|---|
| PubChem CID | 10541710 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3aS,3bR,4R,6aS)-3a,5,5-trimethyl-4-trimethylsilyloxy-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one |
| SMILES | CC1(C)C[C@@H]2CC3=CC(=O)C[C@@]3(C)[C@@H]2[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H28O2Si/c1-16(2)9-11-7-12-8-13(18)10-17(12,3)14(11)15(16)19-20(4,5)6/h8,11,14-15H,7,9-10H2,1-6H3/t11-,14-,15+,17+/m0/s1 |
| InChIKey | FAFXGXXIRRMCEU-ZYIUAKIQSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|