About 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide
1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 10541746) has the molecular formula C16H11N3OS
and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 10541746 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccsc2)n1 |
| InChI | InChI=1S/C16H11N3OS/c17-16(20)13-7-11-10-3-1-2-4-12(10)18-15(11)14(19-13)9-5-6-21-8-9/h1-8,18H,(H2,17,20) |
| InChIKey | NTLDPHVLGSXFAR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide (CID 10541746) is 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide is NC(=O)c1cc2c([nH]c3ccccc32)c(-c2ccsc2)n1.
What is the InChIKey of 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is NTLDPHVLGSXFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3OS/c17-16(20)13-7-11-10-3-1-2-4-12(10)18-15(11)14(19-13)9-5-6-21-8-9/h1-8,18H,(H2,17,20).
What are the key properties of 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide?
1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 293.35 g/mol, XLogP of 3.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thiophen-3-yl-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 10541746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).