About 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine
4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine (PubChem CID 10541761) has the molecular formula C18H15NOS
and a molecular weight of 293.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine |
| PubChem CID | 10541761 |
| Molecular Formula | C18H15NOS |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine |
| SMILES | COc1ccc(C2Sc3ccccc3-n3cccc32)cc1 |
| InChI | InChI=1S/C18H15NOS/c1-20-14-10-8-13(9-11-14)18-16-6-4-12-19(16)15-5-2-3-7-17(15)21-18/h2-12,18H,1H3 |
| InChIKey | YMIXJSCCOUOPPZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine?
The IUPAC name of 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine (CID 10541761) is 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine.
What is the SMILES notation for 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine?
The canonical SMILES for 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine is COc1ccc(C2Sc3ccccc3-n3cccc32)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine?
The InChIKey is YMIXJSCCOUOPPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NOS/c1-20-14-10-8-13(9-11-14)18-16-6-4-12-19(16)15-5-2-3-7-17(15)21-18/h2-12,18H,1H3.
What are the key properties of 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine?
4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine has a molecular weight of 293.39 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazine is sourced from PubChem (CID 10541761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).