C15H19N3O — CID 105417747
3-cyano-N-[[1-(dimethylamino)cyclobutyl]methyl]benzamide (PubChem CID 105417747) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-cyano-N-[[1-(dimethylamino)cyclobutyl]methyl]benzamide.
| Compound Name | 3-cyano-N-[[1-(dimethylamino)cyclobutyl]methyl]benzamide |
|---|---|
| PubChem CID | 105417747 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 3-cyano-N-[[1-(dimethylamino)cyclobutyl]methyl]benzamide |
| SMILES | CN(C)C1(CNC(=O)c2cccc(C#N)c2)CCC1 |
| InChI | InChI=1S/C15H19N3O/c1-18(2)15(7-4-8-15)11-17-14(19)13-6-3-5-12(9-13)10-16/h3,5-6,9H,4,7-8,11H2,1-2H3,(H,17,19) |
| InChIKey | QLBGQTPUYNJCSW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |