About N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine
N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine (PubChem CID 105417884) has the molecular formula C16H35N3
and a molecular weight of 269.48 g/mol. Its IUPAC name is N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine |
| PubChem CID | 105417884 |
| Molecular Formula | C16H35N3 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.28 |
| IUPAC Name | N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine |
| SMILES | CN(CCCCNC(C)(C)C)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C16H35N3/c1-15(2,3)17-12-7-8-13-19(6)14-16(18(4)5)10-9-11-16/h17H,7-14H2,1-6H3 |
| InChIKey | WUFBSZYNICOAQU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine?
The IUPAC name of N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine (CID 105417884) is N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine.
What is the SMILES notation for N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine?
The canonical SMILES for N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine is CN(CCCCNC(C)(C)C)CC1(N(C)C)CCC1.
What is the InChIKey of N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine?
The InChIKey is WUFBSZYNICOAQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35N3/c1-15(2,3)17-12-7-8-13-19(6)14-16(18(4)5)10-9-11-16/h17H,7-14H2,1-6H3.
What are the key properties of N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine?
N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine has a molecular weight of 269.48 g/mol, XLogP of 2.57, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-[[1-(dimethylamino)cyclobutyl]methyl]-N'-methylbutane-1,4-diamine is sourced from PubChem (CID 105417884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).