C16H23FN2O2 — CID 105418433
2-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]-5-fluorobenzoic acid (PubChem CID 105418433) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]-5-fluorobenzoic acid.
| Compound Name | 2-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 105418433 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]-5-fluorobenzoic acid |
| SMILES | CN(Cc1ccc(F)cc1C(=O)O)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C16H23FN2O2/c1-18(2)16(7-4-8-16)11-19(3)10-12-5-6-13(17)9-14(12)15(20)21/h5-6,9H,4,7-8,10-11H2,1-3H3,(H,20,21) |
| InChIKey | RRIOQBJRMAILTD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |