C17H17N3O2 — CID 10541904
ethyl 2-(6-amino-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (PubChem CID 10541904) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 2-(6-amino-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate.
| Compound Name | ethyl 2-(6-amino-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
|---|---|
| PubChem CID | 10541904 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl 2-(6-amino-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| SMILES | CCOC(=O)Cc1c(-c2ccccc2)nc2ccc(N)cn12 |
| InChI | InChI=1S/C17H17N3O2/c1-2-22-16(21)10-14-17(12-6-4-3-5-7-12)19-15-9-8-13(18)11-20(14)15/h3-9,11H,2,10,18H2,1H3 |
| InChIKey | AYRIUPHWCGBAAE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |