C14H27N7 — CID 105420994
2-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-N,4-N,4-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 105420994) has the molecular formula C14H27N7 and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-N,4-N,4-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-N,4-N,4-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 105420994 |
| Molecular Formula | C14H27N7 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 2-N-[[1-(dimethylamino)cyclobutyl]methyl]-2-N,4-N,4-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N(C)C)nc(N(C)CC2(N(C)C)CCC2)n1 |
| InChI | InChI=1S/C14H27N7/c1-15-11-16-12(19(2)3)18-13(17-11)21(6)10-14(20(4)5)8-7-9-14/h7-10H2,1-6H3,(H,15,16,17,18) |
| InChIKey | ATHMXYXBUNWSIU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |