C15H28N6 — CID 105421058
N-[[1-(dimethylamino)cyclobutyl]methyl]-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine (PubChem CID 105421058) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclobutyl]methyl]-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 105421058 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | N-[[1-(dimethylamino)cyclobutyl]methyl]-6-hydrazinyl-N-methyl-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(NN)cc(N(C)CC2(N(C)C)CCC2)n1 |
| InChI | InChI=1S/C15H28N6/c1-11(2)14-17-12(19-16)9-13(18-14)21(5)10-15(20(3)4)7-6-8-15/h9,11H,6-8,10,16H2,1-5H3,(H,17,18,19) |
| InChIKey | RTKYPOYJGCODOY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|