C19H24O3 — CID 10542245
(2S,5S)-2-tert-butyl-5-(cyclohexen-1-yl)-5-phenyl-1,3-dioxolan-4-one (PubChem CID 10542245) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-(cyclohexen-1-yl)-5-phenyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-(cyclohexen-1-yl)-5-phenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 10542245 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-(cyclohexen-1-yl)-5-phenyl-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@](C2=CCCCC2)(c2ccccc2)O1 |
| InChI | InChI=1S/C19H24O3/c1-18(2,3)17-21-16(20)19(22-17,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4,6-7,10-12,17H,5,8-9,13H2,1-3H3/t17-,19-/m1/s1 |
| InChIKey | UXDRPSYSDTWIKB-IEBWSBKVSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|