C7H11N3 — CID 105422534
4-cyclopropyl-1-methylpyrazol-3-amine (PubChem CID 105422534) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 4-cyclopropyl-1-methylpyrazol-3-amine.
| Compound Name | 4-cyclopropyl-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 105422534 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 4-cyclopropyl-1-methylpyrazol-3-amine |
| SMILES | Cn1cc(C2CC2)c(N)n1 |
| InChI | InChI=1S/C7H11N3/c1-10-4-6(5-2-3-5)7(8)9-10/h4-5H,2-3H2,1H3,(H2,8,9) |
| InChIKey | WIGNJMRPAYDYBI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |