About 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone
1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone (PubChem CID 105422636) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone |
| PubChem CID | 105422636 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone |
| SMILES | CC(=O)c1nocc1C1CCC1 |
| InChI | InChI=1S/C9H11NO2/c1-6(11)9-8(5-12-10-9)7-3-2-4-7/h5,7H,2-4H2,1H3 |
| InChIKey | ZFFVOTSMQLBHMO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone?
The IUPAC name of 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone (CID 105422636) is 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone.
What is the SMILES notation for 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone?
The canonical SMILES for 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone is CC(=O)c1nocc1C1CCC1.
What is the InChIKey of 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone?
The InChIKey is ZFFVOTSMQLBHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6(11)9-8(5-12-10-9)7-3-2-4-7/h5,7H,2-4H2,1H3.
What are the key properties of 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone?
1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone has a molecular weight of 165.19 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyclobutyl-1,2-oxazol-3-yl)ethanone is sourced from PubChem (CID 105422636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).