C11H15NO2 — CID 105422883
1-(4-cyclohexyl-1,2-oxazol-3-yl)ethanone (PubChem CID 105422883) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-(4-cyclohexyl-1,2-oxazol-3-yl)ethanone.
| Compound Name | 1-(4-cyclohexyl-1,2-oxazol-3-yl)ethanone |
|---|---|
| PubChem CID | 105422883 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-(4-cyclohexyl-1,2-oxazol-3-yl)ethanone |
| SMILES | CC(=O)c1nocc1C1CCCCC1 |
| InChI | InChI=1S/C11H15NO2/c1-8(13)11-10(7-14-12-11)9-5-3-2-4-6-9/h7,9H,2-6H2,1H3 |
| InChIKey | RFTZLDGFRODVRJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |