C17H27NSi2 — CID 10542351
2,2,5,5-tetramethyl-1-[(2E,4E)-5-phenylpenta-2,4-dienyl]-1,2,5-azadisilolidine (PubChem CID 10542351) has the molecular formula C17H27NSi2 and a molecular weight of 301.58 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1-[(2E,4E)-5-phenylpenta-2,4-dienyl]-1,2,5-azadisilolidine.
| Compound Name | 2,2,5,5-tetramethyl-1-[(2E,4E)-5-phenylpenta-2,4-dienyl]-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 10542351 |
| Molecular Formula | C17H27NSi2 |
| Molecular Weight | 301.58 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2,2,5,5-tetramethyl-1-[(2E,4E)-5-phenylpenta-2,4-dienyl]-1,2,5-azadisilolidine |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1C/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H27NSi2/c1-19(2)15-16-20(3,4)18(19)14-10-6-9-13-17-11-7-5-8-12-17/h5-13H,14-16H2,1-4H3/b10-6+,13-9+ |
| InChIKey | LVPFAEUYFYSMCU-LMZONGNASA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|