C20H18N2O — CID 10542407
15-[2-(dimethylamino)ethyl]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one (PubChem CID 10542407) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one.
| Compound Name | 15-[2-(dimethylamino)ethyl]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one |
|---|---|
| PubChem CID | 10542407 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-8-one |
| SMILES | CN(C)CCc1cc2c3c(cccc3n1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H18N2O/c1-22(2)11-10-13-12-17-14-6-3-4-7-15(14)20(23)16-8-5-9-18(21-13)19(16)17/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | WZMKCXFRVCEKSF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |