C10H11BrO4 — CID 105426089
2-(2-bromo-4,5-dihydroxyphenyl)-2-methylpropanoic acid (PubChem CID 105426089) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dihydroxyphenyl)-2-methylpropanoic acid.
| Compound Name | 2-(2-bromo-4,5-dihydroxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 105426089 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-(2-bromo-4,5-dihydroxyphenyl)-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cc(O)c(O)cc1Br |
| InChI | InChI=1S/C10H11BrO4/c1-10(2,9(14)15)5-3-7(12)8(13)4-6(5)11/h3-4,12-13H,1-2H3,(H,14,15) |
| InChIKey | BQPMFFCQAPGJGL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|