C17H16B2O4 — CID 10542649
(1S,2S,6S,8S)-4,10-diphenyl-3,5,9,11-tetraoxa-4,10-diboratricyclo[6.3.0.02,6]undecane (PubChem CID 10542649) has the molecular formula C17H16B2O4 and a molecular weight of 305.94 g/mol. Its IUPAC name is (1S,2S,6S,8S)-4,10-diphenyl-3,5,9,11-tetraoxa-4,10-diboratricyclo[6.3.0.02,6]undecane.
| Compound Name | (1S,2S,6S,8S)-4,10-diphenyl-3,5,9,11-tetraoxa-4,10-diboratricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 10542649 |
| Molecular Formula | C17H16B2O4 |
| Molecular Weight | 305.94 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (1S,2S,6S,8S)-4,10-diphenyl-3,5,9,11-tetraoxa-4,10-diboratricyclo[6.3.0.02,6]undecane |
| SMILES | c1ccc(B2O[C@@H]3[C@H]4OB(c5ccccc5)O[C@H]4C[C@@H]3O2)cc1 |
| InChI | InChI=1S/C17H16B2O4/c1-3-7-12(8-4-1)18-20-14-11-15-17(16(14)22-18)23-19(21-15)13-9-5-2-6-10-13/h1-10,14-17H,11H2/t14-,15-,16-,17-/m0/s1 |
| InChIKey | VLYPXPHRMMLDBI-QAETUUGQSA-N |
| XLogP | 0.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.94 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|