About 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine
5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine (PubChem CID 10542658) has the molecular formula C12H8BrN3S
and a molecular weight of 306.19 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine.
Molecular Properties
| Compound Name | 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine |
| PubChem CID | 10542658 |
| Molecular Formula | C12H8BrN3S |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine |
| SMILES | Nc1ncc(-c2nc3ccccc3s2)cc1Br |
| InChI | InChI=1S/C12H8BrN3S/c13-8-5-7(6-15-11(8)14)12-16-9-3-1-2-4-10(9)17-12/h1-6H,(H2,14,15) |
| InChIKey | ZONFDPLYLAJVSU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine?
The IUPAC name of 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine (CID 10542658) is 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine.
What is the SMILES notation for 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine?
The canonical SMILES for 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine is Nc1ncc(-c2nc3ccccc3s2)cc1Br.
What is the InChIKey of 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine?
The InChIKey is ZONFDPLYLAJVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrN3S/c13-8-5-7(6-15-11(8)14)12-16-9-3-1-2-4-10(9)17-12/h1-6H,(H2,14,15).
What are the key properties of 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine?
5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine has a molecular weight of 306.19 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzothiazol-2-yl)-3-bromopyridin-2-amine is sourced from PubChem (CID 10542658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).