About 4-fluoropyrrolidin-2-one
4-fluoropyrrolidin-2-one (PubChem CID 105426949) has the molecular formula C4H6FNO
and a molecular weight of 103.10 g/mol. Its IUPAC name is 4-fluoropyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-fluoropyrrolidin-2-one |
| PubChem CID | 105426949 |
| Molecular Formula | C4H6FNO |
| Molecular Weight | 103.10 g/mol |
| Exact Mass | 103.04 |
| IUPAC Name | 4-fluoropyrrolidin-2-one |
| SMILES | O=C1CC(F)CN1 |
| InChI | InChI=1S/C4H6FNO/c5-3-1-4(7)6-2-3/h3H,1-2H2,(H,6,7) |
| InChIKey | NXHUUQKYJFXGMA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.10 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoropyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropyrrolidin-2-one?
The IUPAC name of 4-fluoropyrrolidin-2-one (CID 105426949) is 4-fluoropyrrolidin-2-one.
What is the SMILES notation for 4-fluoropyrrolidin-2-one?
The canonical SMILES for 4-fluoropyrrolidin-2-one is O=C1CC(F)CN1.
What is the InChIKey of 4-fluoropyrrolidin-2-one?
The InChIKey is NXHUUQKYJFXGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6FNO/c5-3-1-4(7)6-2-3/h3H,1-2H2,(H,6,7).
What are the key properties of 4-fluoropyrrolidin-2-one?
4-fluoropyrrolidin-2-one has a molecular weight of 103.10 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropyrrolidin-2-one is sourced from PubChem (CID 105426949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).