C6H11FN2 — CID 105427520
8-fluoro-3,6-diazabicyclo[3.2.1]octane (PubChem CID 105427520) has the molecular formula C6H11FN2 and a molecular weight of 130.17 g/mol. Its IUPAC name is 8-fluoro-3,6-diazabicyclo[3.2.1]octane.
| Compound Name | 8-fluoro-3,6-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 105427520 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 8-fluoro-3,6-diazabicyclo[3.2.1]octane |
| SMILES | FC1C2CNCC1NC2 |
| InChI | InChI=1S/C6H11FN2/c7-6-4-1-8-3-5(6)9-2-4/h4-6,8-9H,1-3H2 |
| InChIKey | WZRIZCLXOLZBEV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |