C6H11FN2 — CID 105427521
fluoro(1,2,3,6-tetrahydropyridin-4-yl)methanamine (PubChem CID 105427521) has the molecular formula C6H11FN2 and a molecular weight of 130.17 g/mol. Its IUPAC name is fluoro(1,2,3,6-tetrahydropyridin-4-yl)methanamine.
| Compound Name | fluoro(1,2,3,6-tetrahydropyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 105427521 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | fluoro(1,2,3,6-tetrahydropyridin-4-yl)methanamine |
| SMILES | NC(F)C1=CCNCC1 |
| InChI | InChI=1S/C6H11FN2/c7-6(8)5-1-3-9-4-2-5/h1,6,9H,2-4,8H2 |
| InChIKey | GZRFETYOHZSUQQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|