About 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine
3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine (PubChem CID 105427752) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine.
Analyze 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The IUPAC name of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine (CID 105427752) is 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine.
What is the SMILES notation for 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The canonical SMILES for 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine is Cc1ccc2c(c1)CC2N.
What is the InChIKey of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The InChIKey is AQLGCGOTHWIJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-6-2-3-8-7(4-6)5-9(8)10/h2-4,9H,5,10H2,1H3.
What are the key properties of 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine has a molecular weight of 133.19 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine is sourced from PubChem (CID 105427752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).