About 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine
6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine (PubChem CID 105428021) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine.
Analyze 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine?
The IUPAC name of 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine (CID 105428021) is 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine.
What is the SMILES notation for 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine?
The canonical SMILES for 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine is Nc1cnn2c1COCC2.
What is the InChIKey of 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine?
The InChIKey is NXZCEONGJPCYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c7-5-3-8-9-1-2-10-4-6(5)9/h3H,1-2,4,7H2.
What are the key properties of 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine?
6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine has a molecular weight of 139.16 g/mol, XLogP of -0.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-amine is sourced from PubChem (CID 105428021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).