About 1,5-diethylpyrazol-4-ol
1,5-diethylpyrazol-4-ol (PubChem CID 105428143) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,5-diethylpyrazol-4-ol.
Molecular Properties
| Compound Name | 1,5-diethylpyrazol-4-ol |
| PubChem CID | 105428143 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1,5-diethylpyrazol-4-ol |
| SMILES | CCc1c(O)cnn1CC |
| InChI | InChI=1S/C7H12N2O/c1-3-6-7(10)5-8-9(6)4-2/h5,10H,3-4H2,1-2H3 |
| InChIKey | YNHTUDURBZCIGO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-diethylpyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diethylpyrazol-4-ol?
The IUPAC name of 1,5-diethylpyrazol-4-ol (CID 105428143) is 1,5-diethylpyrazol-4-ol.
What is the SMILES notation for 1,5-diethylpyrazol-4-ol?
The canonical SMILES for 1,5-diethylpyrazol-4-ol is CCc1c(O)cnn1CC.
What is the InChIKey of 1,5-diethylpyrazol-4-ol?
The InChIKey is YNHTUDURBZCIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-6-7(10)5-8-9(6)4-2/h5,10H,3-4H2,1-2H3.
What are the key properties of 1,5-diethylpyrazol-4-ol?
1,5-diethylpyrazol-4-ol has a molecular weight of 140.19 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diethylpyrazol-4-ol is sourced from PubChem (CID 105428143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).