C7H13FN2 — CID 105428657
2-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)ethanamine (PubChem CID 105428657) has the molecular formula C7H13FN2 and a molecular weight of 144.19 g/mol. Its IUPAC name is 2-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)ethanamine.
| Compound Name | 2-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)ethanamine |
|---|---|
| PubChem CID | 105428657 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 2-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)ethanamine |
| SMILES | NCC(F)C1=CCNCC1 |
| InChI | InChI=1S/C7H13FN2/c8-7(5-9)6-1-3-10-4-2-6/h1,7,10H,2-5,9H2 |
| InChIKey | MFYZSYOSHFHVHY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|