About 3-cyclopropyl-4,4-difluorobutanenitrile
3-cyclopropyl-4,4-difluorobutanenitrile (PubChem CID 105428729) has the molecular formula C7H9F2N
and a molecular weight of 145.15 g/mol. Its IUPAC name is 3-cyclopropyl-4,4-difluorobutanenitrile.
Molecular Properties
| Compound Name | 3-cyclopropyl-4,4-difluorobutanenitrile |
| PubChem CID | 105428729 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 3-cyclopropyl-4,4-difluorobutanenitrile |
| SMILES | N#CCC(C(F)F)C1CC1 |
| InChI | InChI=1S/C7H9F2N/c8-7(9)6(3-4-10)5-1-2-5/h5-7H,1-3H2 |
| InChIKey | DNNYOCIMHLCWKA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopropyl-4,4-difluorobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-4,4-difluorobutanenitrile?
The IUPAC name of 3-cyclopropyl-4,4-difluorobutanenitrile (CID 105428729) is 3-cyclopropyl-4,4-difluorobutanenitrile.
What is the SMILES notation for 3-cyclopropyl-4,4-difluorobutanenitrile?
The canonical SMILES for 3-cyclopropyl-4,4-difluorobutanenitrile is N#CCC(C(F)F)C1CC1.
What is the InChIKey of 3-cyclopropyl-4,4-difluorobutanenitrile?
The InChIKey is DNNYOCIMHLCWKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N/c8-7(9)6(3-4-10)5-1-2-5/h5-7H,1-3H2.
What are the key properties of 3-cyclopropyl-4,4-difluorobutanenitrile?
3-cyclopropyl-4,4-difluorobutanenitrile has a molecular weight of 145.15 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-4,4-difluorobutanenitrile is sourced from PubChem (CID 105428729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).