About 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one
2-(3-hydroxypropyl)-1,2-oxazolidin-5-one (PubChem CID 105428747) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one.
Molecular Properties
| Compound Name | 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one |
| PubChem CID | 105428747 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one |
| SMILES | O=C1CCN(CCCO)O1 |
| InChI | InChI=1S/C6H11NO3/c8-5-1-3-7-4-2-6(9)10-7/h8H,1-5H2 |
| InChIKey | HAPRHJBYLNQBGR-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one?
The IUPAC name of 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one (CID 105428747) is 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one.
What is the SMILES notation for 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one?
The canonical SMILES for 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one is O=C1CCN(CCCO)O1.
What is the InChIKey of 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one?
The InChIKey is HAPRHJBYLNQBGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c8-5-1-3-7-4-2-6(9)10-7/h8H,1-5H2.
What are the key properties of 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one?
2-(3-hydroxypropyl)-1,2-oxazolidin-5-one has a molecular weight of 145.16 g/mol, XLogP of -0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxypropyl)-1,2-oxazolidin-5-one is sourced from PubChem (CID 105428747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).