2-(3-methoxyazetidin-3-yl)acetic acid

C6H11NO3 — CID 105428756

IUPAC2-(3-methoxyazetidin-3-yl)acetic acid
SMILESCOC1(CC(=O)O)CNC1
InChIInChI=1S/C6H11NO3/c1-10-6(2-5(8)9)3-7-4-6/h7H,2-4H2,1H3,(H,8,9)
InChIKeyMQWACXONDOABMC-UHFFFAOYSA-N
MW145.16 g/mol
LogP-0.55
Rot. Bonds3

About 2-(3-methoxyazetidin-3-yl)acetic acid

2-(3-methoxyazetidin-3-yl)acetic acid (PubChem CID 105428756) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-(3-methoxyazetidin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(3-methoxyazetidin-3-yl)acetic acid
PubChem CID105428756
Molecular FormulaC6H11NO3
Molecular Weight145.16 g/mol
Exact Mass145.07
IUPAC Name2-(3-methoxyazetidin-3-yl)acetic acid
SMILESCOC1(CC(=O)O)CNC1
InChIInChI=1S/C6H11NO3/c1-10-6(2-5(8)9)3-7-4-6/h7H,2-4H2,1H3,(H,8,9)
InChIKeyMQWACXONDOABMC-UHFFFAOYSA-N
XLogP-0.55
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.16
LogP ≤ 5-0.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(3-methoxyazetidin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-propoxyazetidin-3-yl)acetic acid
CID 107140834
2-[3-[2-(2-methoxyethoxy)ethoxy]azetidin-3-yl]acetic acid
CID 107140977
2-[3-(4-methylpentan-2-yloxy)azetidin-3-yl]acetic acid
CID 107140761
2-(4-methoxyoxan-4-yl)acetic acid
CID 84654866
2-[3-(4-acetylphenoxy)azetidin-3-yl]acetic acid
CID 107140663
2-[3-(4-iodophenoxy)azetidin-3-yl]acetic acid
CID 107140804
2-(3-but-3-enoxyazetidin-3-yl)acetic acid
CID 107140799
3-ethyl-3-methoxyazetidine;hydrochloride
CID 66592095
2-[3-(4-propanoylphenoxy)azetidin-3-yl]acetic acid
CID 107140698
2-(4-methoxy-1-propan-2-ylpiperidin-4-yl)acetic acid
CID 105468786
2-[3-[(2-ethyl-6-methyl-3-pyridinyl)oxy]azetidin-3-yl]acetic acid
CID 107141007
2-[3-(3,4-dimethoxypyrrolidin-1-yl)azetidin-3-yl]acetic acid
CID 107143242

Frequently Asked Questions

What is the IUPAC name of 2-(3-methoxyazetidin-3-yl)acetic acid?
The IUPAC name of 2-(3-methoxyazetidin-3-yl)acetic acid (CID 105428756) is 2-(3-methoxyazetidin-3-yl)acetic acid.
What is the SMILES notation for 2-(3-methoxyazetidin-3-yl)acetic acid?
The canonical SMILES for 2-(3-methoxyazetidin-3-yl)acetic acid is COC1(CC(=O)O)CNC1.
What is the InChIKey of 2-(3-methoxyazetidin-3-yl)acetic acid?
The InChIKey is MQWACXONDOABMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-10-6(2-5(8)9)3-7-4-6/h7H,2-4H2,1H3,(H,8,9).
What are the key properties of 2-(3-methoxyazetidin-3-yl)acetic acid?
2-(3-methoxyazetidin-3-yl)acetic acid has a molecular weight of 145.16 g/mol, XLogP of -0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyazetidin-3-yl)acetic acid is sourced from PubChem (CID 105428756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).