About 4-(1-fluoroethyl)azepane
4-(1-fluoroethyl)azepane (PubChem CID 105428868) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is 4-(1-fluoroethyl)azepane.
Molecular Properties
| Compound Name | 4-(1-fluoroethyl)azepane |
| PubChem CID | 105428868 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 4-(1-fluoroethyl)azepane |
| SMILES | CC(F)C1CCCNCC1 |
| InChI | InChI=1S/C8H16FN/c1-7(9)8-3-2-5-10-6-4-8/h7-8,10H,2-6H2,1H3 |
| InChIKey | BPGVJXYVSMPGSP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1-fluoroethyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-fluoroethyl)azepane?
The IUPAC name of 4-(1-fluoroethyl)azepane (CID 105428868) is 4-(1-fluoroethyl)azepane.
What is the SMILES notation for 4-(1-fluoroethyl)azepane?
The canonical SMILES for 4-(1-fluoroethyl)azepane is CC(F)C1CCCNCC1.
What is the InChIKey of 4-(1-fluoroethyl)azepane?
The InChIKey is BPGVJXYVSMPGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FN/c1-7(9)8-3-2-5-10-6-4-8/h7-8,10H,2-6H2,1H3.
What are the key properties of 4-(1-fluoroethyl)azepane?
4-(1-fluoroethyl)azepane has a molecular weight of 145.22 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-fluoroethyl)azepane is sourced from PubChem (CID 105428868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).