About 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane
8,8-difluoro-3,6-diazabicyclo[3.2.1]octane (PubChem CID 105429167) has the molecular formula C6H10F2N2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane |
| PubChem CID | 105429167 |
| Molecular Formula | C6H10F2N2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane |
| SMILES | FC1(F)C2CNCC1NC2 |
| InChI | InChI=1S/C6H10F2N2/c7-6(8)4-1-9-3-5(6)10-2-4/h4-5,9-10H,1-3H2 |
| InChIKey | ASMVESAXWXHFNB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane?
The IUPAC name of 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane (CID 105429167) is 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane?
The canonical SMILES for 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane is FC1(F)C2CNCC1NC2.
What is the InChIKey of 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane?
The InChIKey is ASMVESAXWXHFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N2/c7-6(8)4-1-9-3-5(6)10-2-4/h4-5,9-10H,1-3H2.
What are the key properties of 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane?
8,8-difluoro-3,6-diazabicyclo[3.2.1]octane has a molecular weight of 148.16 g/mol, XLogP of -0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-difluoro-3,6-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 105429167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).