About (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol
(3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol (PubChem CID 105429222) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol.
Molecular Properties
| Compound Name | (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol |
| PubChem CID | 105429222 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol |
| SMILES | Cc1ccc2c(c1)CC2CO |
| InChI | InChI=1S/C10H12O/c1-7-2-3-10-8(4-7)5-9(10)6-11/h2-4,9,11H,5-6H2,1H3 |
| InChIKey | VQNJBIZCZIWPIG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol?
The IUPAC name of (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol (CID 105429222) is (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol.
What is the SMILES notation for (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol?
The canonical SMILES for (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol is Cc1ccc2c(c1)CC2CO.
What is the InChIKey of (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol?
The InChIKey is VQNJBIZCZIWPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-7-2-3-10-8(4-7)5-9(10)6-11/h2-4,9,11H,5-6H2,1H3.
What are the key properties of (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol?
(3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol has a molecular weight of 148.20 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanol is sourced from PubChem (CID 105429222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).